C22H22FN5O4S — CID 123741688
N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-5-isocyano-3-methylpyridine-2-carboxamide (PubChem CID 123741688) has the molecular formula C22H22FN5O4S and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-5-isocyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-5-isocyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123741688 |
| Molecular Formula | C22H22FN5O4S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-5-isocyano-3-methylpyridine-2-carboxamide |
| SMILES | [C-]#[N+]c1cnc(C(=O)Nc2ccc(F)c([C@]34COC[C@H]3S(=O)(=O)C(C)(C)C(N)=N4)c2)c(C)c1 |
| InChI | InChI=1S/C22H22FN5O4S/c1-12-7-14(25-4)9-26-18(12)19(29)27-13-5-6-16(23)15(8-13)22-11-32-10-17(22)33(30,31)21(2,3)20(24)28-22/h5-9,17H,10-11H2,1-3H3,(H2,24,28)(H,27,29)/t17-,22-/m1/s1 |
| InChIKey | LYPFVOLIEWADSI-VGOFRKELSA-N |
| XLogP | 2.49 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|