C21H22Cl2FN5O2S — CID 126583823
N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-3,5-dichloropyridine-2-carboxamide (PubChem CID 126583823) has the molecular formula C21H22Cl2FN5O2S and a molecular weight of 498.41 g/mol. Its IUPAC name is N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-3,5-dichloropyridine-2-carboxamide.
| Compound Name | N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-3,5-dichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 126583823 |
| Molecular Formula | C21H22Cl2FN5O2S |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-3,5-dichloropyridine-2-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)c3ncc(Cl)cc3Cl)ccc2F)C2CCN=[S@@]21=O |
| InChI | InChI=1S/C21H22Cl2FN5O2S/c1-20(2)19(25)29-21(3,16-6-7-27-32(16,20)31)13-9-12(4-5-15(13)24)28-18(30)17-14(23)8-11(22)10-26-17/h4-5,8-10,16H,6-7H2,1-3H3,(H2,25,29)(H,28,30)/t16?,21-,32-/m1/s1 |
| InChIKey | MBAHKAQDPKHHJD-MFJOZYMNSA-N |
| XLogP | 4.38 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |