C22H24F2N4O2S — CID 158456964
2-[3-[(1R,5R,6S)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone (PubChem CID 158456964) has the molecular formula C22H24F2N4O2S and a molecular weight of 446.52 g/mol. Its IUPAC name is 2-[3-[(1R,5R,6S)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(1R,5R,6S)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 158456964 |
| Molecular Formula | C22H24F2N4O2S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[3-[(1R,5R,6S)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(CC(=O)c3ccc(F)cn3)ccc2F)[C@@H]2CCN=[S@@]21=O |
| InChI | InChI=1S/C22H24F2N4O2S/c1-21(2)20(25)28-22(3,19-8-9-27-31(19,21)30)15-10-13(4-6-16(15)24)11-18(29)17-7-5-14(23)12-26-17/h4-7,10,12,19H,8-9,11H2,1-3H3,(H2,25,28)/t19-,22+,31+/m0/s1 |
| InChIKey | HERPXRBZTHGOIF-YWSFSJNBSA-N |
| XLogP | 3.39 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |