C20H18F5N3O3 — CID 147594339
2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone (PubChem CID 147594339) has the molecular formula C20H18F5N3O3 and a molecular weight of 443.37 g/mol. Its IUPAC name is 2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 147594339 |
| Molecular Formula | C20H18F5N3O3 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[3-[(4R,5R)-2-amino-4-methyl-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(5-fluoro-2-pyridinyl)ethanone |
| SMILES | C[C@]1(c2cc(CC(=O)c3ccc(F)cn3)ccc2F)N=C(N)OC[C@@H]1OCC(F)(F)F |
| InChI | InChI=1S/C20H18F5N3O3/c1-19(17(9-30-18(26)28-19)31-10-20(23,24)25)13-6-11(2-4-14(13)22)7-16(29)15-5-3-12(21)8-27-15/h2-6,8,17H,7,9-10H2,1H3,(H2,26,28)/t17-,19+/m0/s1 |
| InChIKey | FYWSVTGRTVDWOU-PKOBYXMFSA-N |
| XLogP | 3.29 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |