C22H21F6N3O5 — CID 159456669
2-[3-[(5R)-3-amino-6,6-difluoro-5-methyl-2,7-dihydro-1,4-oxazepin-5-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone;formic acid (PubChem CID 159456669) has the molecular formula C22H21F6N3O5 and a molecular weight of 521.41 g/mol. Its IUPAC name is 2-[3-[(5R)-3-amino-6,6-difluoro-5-methyl-2,7-dihydro-1,4-oxazepin-5-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone;formic acid.
| Compound Name | 2-[3-[(5R)-3-amino-6,6-difluoro-5-methyl-2,7-dihydro-1,4-oxazepin-5-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone;formic acid |
|---|---|
| PubChem CID | 159456669 |
| Molecular Formula | C22H21F6N3O5 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[3-[(5R)-3-amino-6,6-difluoro-5-methyl-2,7-dihydro-1,4-oxazepin-5-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone;formic acid |
| SMILES | C[C@]1(c2cc(CC(=O)c3ccc(OCC(F)(F)F)cn3)ccc2F)N=C(N)COCC1(F)F.O=CO |
| InChI | InChI=1S/C21H19F6N3O3.CH2O2/c1-19(20(23,24)10-32-9-18(28)30-19)14-6-12(2-4-15(14)22)7-17(31)16-5-3-13(8-29-16)33-11-21(25,26)27;2-1-3/h2-6,8H,7,9-11H2,1H3,(H2,28,30);1H,(H,2,3)/t19-;/m1./s1 |
| InChIKey | LUBHHWNHEUEQCI-FSRHSHDFSA-N |
| XLogP | 3.53 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|