C24H24F3N3O5 — CID 158327362
CID 158327362 (PubChem CID 158327362) has the molecular formula C24H24F3N3O5 and a molecular weight of 491.47 g/mol.
| Compound Name | CID 158327362 |
|---|---|
| PubChem CID | 158327362 |
| Molecular Formula | C24H24F3N3O5 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | — |
| SMILES | CC1(C)Oc2ccc(CC(=O)c3ccc(OCC(F)(F)F)cn3)cc2C2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C24H24F3N3O5/c1-21(2)22(10-32-11-22)23(12-34-20(28)30-23)16-7-14(3-6-19(16)35-21)8-18(31)17-5-4-15(9-29-17)33-13-24(25,26)27/h3-7,9H,8,10-13H2,1-2H3,(H2,28,30) |
| InChIKey | GPOOLMBLEYRSIM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |