About CID 147485411
CID 147485411 (PubChem CID 147485411) has the molecular formula C20H22N4O5
and a molecular weight of 398.42 g/mol.
Molecular Properties
| Compound Name | CID 147485411 |
| PubChem CID | 147485411 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | — |
| SMILES | Cc1nnc(C(=O)Cc2ccc3c(c2)C2(COC(N)=N2)C2(COC2)C(C)(C)O3)o1 |
| InChI | InChI=1S/C20H22N4O5/c1-11-23-24-16(28-11)14(25)7-12-4-5-15-13(6-12)20(10-27-17(21)22-20)19(8-26-9-19)18(2,3)29-15/h4-6H,7-10H2,1-3H3,(H2,21,22) |
| InChIKey | FELZTFPWDMAMCF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze CID 147485411 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147485411?
The IUPAC name of CID 147485411 (CID 147485411) is not available.
What is the SMILES notation for CID 147485411?
The canonical SMILES for CID 147485411 is Cc1nnc(C(=O)Cc2ccc3c(c2)C2(COC(N)=N2)C2(COC2)C(C)(C)O3)o1.
What is the InChIKey of CID 147485411?
The InChIKey is FELZTFPWDMAMCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O5/c1-11-23-24-16(28-11)14(25)7-12-4-5-15-13(6-12)20(10-27-17(21)22-20)19(8-26-9-19)18(2,3)29-15/h4-6H,7-10H2,1-3H3,(H2,21,22).
What are the key properties of CID 147485411?
CID 147485411 has a molecular weight of 398.42 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147485411 is sourced from PubChem (CID 147485411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).