About CID 90055966
CID 90055966 (PubChem CID 90055966) has the molecular formula C22H22N4O3
and a molecular weight of 390.44 g/mol.
Molecular Properties
| Compound Name | CID 90055966 |
| PubChem CID | 90055966 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | — |
| SMILES | CC1(C)Oc2ccc(-c3ccc4[nH]ncc4c3)cc2C2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C22H22N4O3/c1-20(2)21(10-27-11-21)22(12-28-19(23)25-22)16-8-14(4-6-18(16)29-20)13-3-5-17-15(7-13)9-24-26-17/h3-9H,10-12H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | WSZIQFROVOJHOO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 90055966 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90055966?
The IUPAC name of CID 90055966 (CID 90055966) is not available.
What is the SMILES notation for CID 90055966?
The canonical SMILES for CID 90055966 is CC1(C)Oc2ccc(-c3ccc4[nH]ncc4c3)cc2C2(COC(N)=N2)C12COC2.
What is the InChIKey of CID 90055966?
The InChIKey is WSZIQFROVOJHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O3/c1-20(2)21(10-27-11-21)22(12-28-19(23)25-22)16-8-14(4-6-18(16)29-20)13-3-5-17-15(7-13)9-24-26-17/h3-9H,10-12H2,1-2H3,(H2,23,25)(H,24,26).
What are the key properties of CID 90055966?
CID 90055966 has a molecular weight of 390.44 g/mol, XLogP of 2.96, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90055966 is sourced from PubChem (CID 90055966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).