About CID 90056474
CID 90056474 (PubChem CID 90056474) has the molecular formula C22H21FN2O3
and a molecular weight of 380.42 g/mol.
Molecular Properties
| Compound Name | CID 90056474 |
| PubChem CID | 90056474 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | — |
| SMILES | NC1=NC2(CO1)c1cc(-c3ccccc3F)ccc1OC1(CCC1)C21COC1 |
| InChI | InChI=1S/C22H21FN2O3/c23-17-5-2-1-4-15(17)14-6-7-18-16(10-14)22(13-27-19(24)25-22)20(11-26-12-20)21(28-18)8-3-9-21/h1-2,4-7,10H,3,8-9,11-13H2,(H2,24,25) |
| InChIKey | PQPCAOQHCPZEDG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 90056474 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90056474?
The IUPAC name of CID 90056474 (CID 90056474) is not available.
What is the SMILES notation for CID 90056474?
The canonical SMILES for CID 90056474 is NC1=NC2(CO1)c1cc(-c3ccccc3F)ccc1OC1(CCC1)C21COC1.
What is the InChIKey of CID 90056474?
The InChIKey is PQPCAOQHCPZEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN2O3/c23-17-5-2-1-4-15(17)14-6-7-18-16(10-14)22(13-27-19(24)25-22)20(11-26-12-20)21(28-18)8-3-9-21/h1-2,4-7,10H,3,8-9,11-13H2,(H2,24,25).
What are the key properties of CID 90056474?
CID 90056474 has a molecular weight of 380.42 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90056474 is sourced from PubChem (CID 90056474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).