About CID 90054965
CID 90054965 (PubChem CID 90054965) has the molecular formula C20H19Cl2N3O3
and a molecular weight of 420.30 g/mol.
Molecular Properties
| Compound Name | CID 90054965 |
| PubChem CID | 90054965 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | — |
| SMILES | CC1(C)Oc2ccc(-c3ccnc(Cl)c3Cl)cc2C2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-18(2)19(8-26-9-19)20(10-27-17(23)25-20)13-7-11(3-4-14(13)28-18)12-5-6-24-16(22)15(12)21/h3-7H,8-10H2,1-2H3,(H2,23,25) |
| InChIKey | SEAPOZKSVDOWPZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze CID 90054965 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90054965?
The IUPAC name of CID 90054965 (CID 90054965) is not available.
What is the SMILES notation for CID 90054965?
The canonical SMILES for CID 90054965 is CC1(C)Oc2ccc(-c3ccnc(Cl)c3Cl)cc2C2(COC(N)=N2)C12COC2.
What is the InChIKey of CID 90054965?
The InChIKey is SEAPOZKSVDOWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2N3O3/c1-18(2)19(8-26-9-19)20(10-27-17(23)25-20)13-7-11(3-4-14(13)28-18)12-5-6-24-16(22)15(12)21/h3-7H,8-10H2,1-2H3,(H2,23,25).
What are the key properties of CID 90054965?
CID 90054965 has a molecular weight of 420.30 g/mol, XLogP of 3.78, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90054965 is sourced from PubChem (CID 90054965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).