About CID 90056272
CID 90056272 (PubChem CID 90056272) has the molecular formula C23H23F3N4O5
and a molecular weight of 492.45 g/mol.
Molecular Properties
| Compound Name | CID 90056272 |
| PubChem CID | 90056272 |
| Molecular Formula | C23H23F3N4O5 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | — |
| SMILES | CC1(C)Oc2ccc(NC(=O)c3ccc(OCC(F)(F)F)nc3)cc2C2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C23H23F3N4O5/c1-20(2)21(9-32-10-21)22(11-34-19(27)30-22)15-7-14(4-5-16(15)35-20)29-18(31)13-3-6-17(28-8-13)33-12-23(24,25)26/h3-8H,9-12H2,1-2H3,(H2,27,30)(H,29,31) |
| InChIKey | NSLUXYFBACHKIA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 90056272 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90056272?
The IUPAC name of CID 90056272 (CID 90056272) is not available.
What is the SMILES notation for CID 90056272?
The canonical SMILES for CID 90056272 is CC1(C)Oc2ccc(NC(=O)c3ccc(OCC(F)(F)F)nc3)cc2C2(COC(N)=N2)C12COC2.
What is the InChIKey of CID 90056272?
The InChIKey is NSLUXYFBACHKIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F3N4O5/c1-20(2)21(9-32-10-21)22(11-34-19(27)30-22)15-7-14(4-5-16(15)35-20)29-18(31)13-3-6-17(28-8-13)33-12-23(24,25)26/h3-8H,9-12H2,1-2H3,(H2,27,30)(H,29,31).
What are the key properties of CID 90056272?
CID 90056272 has a molecular weight of 492.45 g/mol, XLogP of 3.00, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90056272 is sourced from PubChem (CID 90056272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).