C21H20F4N4O4 — CID 123737721
N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 123737721) has the molecular formula C21H20F4N4O4 and a molecular weight of 468.41 g/mol. Its IUPAC name is N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123737721 |
| Molecular Formula | C21H20F4N4O4 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | CC12COCC1(c1cc(NC(=O)c3ccc(OCC(F)(F)F)cn3)ccc1F)N=C(N)OC2 |
| InChI | InChI=1S/C21H20F4N4O4/c1-19-8-31-10-20(19,29-18(26)33-9-19)14-6-12(2-4-15(14)22)28-17(30)16-5-3-13(7-27-16)32-11-21(23,24)25/h2-7H,8-11H2,1H3,(H2,26,29)(H,28,30) |
| InChIKey | BLONTSRZJTXJIH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |