C22H24F4N4O3S — CID 126488561
N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 126488561) has the molecular formula C22H24F4N4O3S and a molecular weight of 500.52 g/mol. Its IUPAC name is N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126488561 |
| Molecular Formula | C22H24F4N4O3S |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | COC[C@@]1(C)C[C@@](C)(c2cc(NC(=O)c3ccc(OCC(F)(F)F)cn3)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C22H24F4N4O3S/c1-20(11-32-3)10-21(2,30-19(27)34-20)15-8-13(4-6-16(15)23)29-18(31)17-7-5-14(9-28-17)33-12-22(24,25)26/h4-9H,10-12H2,1-3H3,(H2,27,30)(H,29,31)/t20-,21+/m1/s1 |
| InChIKey | ZCJSHHVBHBXPNW-RTWAWAEBSA-N |
| XLogP | 4.49 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |