C22H22F6N4O2S — CID 126488754
N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 126488754) has the molecular formula C22H22F6N4O2S and a molecular weight of 520.50 g/mol. Its IUPAC name is N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126488754 |
| Molecular Formula | C22H22F6N4O2S |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | Cc1cc(OCC(F)(F)F)cnc1C(=O)Nc1cc(F)c(F)c([C@]2(C)C[C@](C)(CF)SC(N)=N2)c1 |
| InChI | InChI=1S/C22H22F6N4O2S/c1-11-4-13(34-10-22(26,27)28)7-30-17(11)18(33)31-12-5-14(16(25)15(24)6-12)21(3)8-20(2,9-23)35-19(29)32-21/h4-7H,8-10H2,1-3H3,(H2,29,32)(H,31,33)/t20-,21+/m1/s1 |
| InChIKey | KUULXSRTIOJIKW-RTWAWAEBSA-N |
| XLogP | 5.26 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |