C23H26F5N5O3S — CID 126488600
N-[3-[(4S,6S)-2-amino-6-(methoxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 126488600) has the molecular formula C23H26F5N5O3S and a molecular weight of 547.55 g/mol. Its IUPAC name is N-[3-[(4S,6S)-2-amino-6-(methoxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,6S)-2-amino-6-(methoxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126488600 |
| Molecular Formula | C23H26F5N5O3S |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | N-[3-[(4S,6S)-2-amino-6-(methoxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | COC[C@@]1(C)SC(N)=N[C@](C)(c2cc(NC(=O)c3ncc(OCC(F)(F)F)nc3C)cc(F)c2F)C1C |
| InChI | InChI=1S/C23H26F5N5O3S/c1-11-18(30-8-16(31-11)36-10-23(26,27)28)19(34)32-13-6-14(17(25)15(24)7-13)22(4)12(2)21(3,9-35-5)37-20(29)33-22/h6-8,12H,9-10H2,1-5H3,(H2,29,33)(H,32,34)/t12?,21-,22+/m1/s1 |
| InChIKey | KAMRBLGQNVUOHK-KOTNHICISA-N |
| XLogP | 4.57 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |