C21H20F7N5O2S — CID 130434809
N-[3-[(4S,6R)-2-amino-6-(difluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 130434809) has the molecular formula C21H20F7N5O2S and a molecular weight of 539.48 g/mol. Its IUPAC name is N-[3-[(4S,6R)-2-amino-6-(difluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,6R)-2-amino-6-(difluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 130434809 |
| Molecular Formula | C21H20F7N5O2S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N-[3-[(4S,6R)-2-amino-6-(difluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | Cc1nc(OCC(F)(F)F)cnc1C(=O)Nc1cc(F)c(F)c([C@]2(C)C[C@](C)(C(F)F)SC(N)=N2)c1 |
| InChI | InChI=1S/C21H20F7N5O2S/c1-9-15(30-6-13(31-9)35-8-21(26,27)28)16(34)32-10-4-11(14(23)12(22)5-10)19(2)7-20(3,17(24)25)36-18(29)33-19/h4-6,17H,7-8H2,1-3H3,(H2,29,33)(H,32,34)/t19-,20+/m0/s1 |
| InChIKey | HZDATWKCKRFRIP-VQTJNVASSA-N |
| XLogP | 4.95 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |