C22H22F6N6O3S — CID 126488419
(4S,6R)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide (PubChem CID 126488419) has the molecular formula C22H22F6N6O3S and a molecular weight of 564.51 g/mol. Its IUPAC name is (4S,6R)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,6R)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 126488419 |
| Molecular Formula | C22H22F6N6O3S |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | (4S,6R)-2-amino-N-(2,2-difluoroethyl)-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide |
| SMILES | C[C@]1(C(=O)NCC(F)F)C[C@@](C)(c2cc(NC(=O)c3cnc(OCC(F)(F)F)cn3)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C22H22F6N6O3S/c1-20(9-21(2,38-19(29)34-20)18(36)32-7-15(24)25)12-5-11(3-4-13(12)23)33-17(35)14-6-31-16(8-30-14)37-10-22(26,27)28/h3-6,8,15H,7,9-10H2,1-2H3,(H2,29,34)(H,32,36)(H,33,35)/t20-,21+/m0/s1 |
| InChIKey | DJDHEYQEONOTTH-LEWJYISDSA-N |
| XLogP | 3.62 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |