C26H32F4N6O3S — CID 118884814
(4S,6S)-2-amino-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,5,6-trimethyl-N-[(2R)-3-methylbutan-2-yl]-5H-1,3-thiazine-6-carboxamide (PubChem CID 118884814) has the molecular formula C26H32F4N6O3S and a molecular weight of 584.64 g/mol. Its IUPAC name is (4S,6S)-2-amino-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,5,6-trimethyl-N-[(2R)-3-methylbutan-2-yl]-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,6S)-2-amino-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,5,6-trimethyl-N-[(2R)-3-methylbutan-2-yl]-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 118884814 |
| Molecular Formula | C26H32F4N6O3S |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | (4S,6S)-2-amino-4-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-4,5,6-trimethyl-N-[(2R)-3-methylbutan-2-yl]-5H-1,3-thiazine-6-carboxamide |
| SMILES | CC(C)[C@@H](C)NC(=O)[C@@]1(C)SC(N)=N[C@](C)(c2cc(NC(=O)c3cnc(OCC(F)(F)F)cn3)ccc2F)C1C |
| InChI | InChI=1S/C26H32F4N6O3S/c1-13(2)14(3)34-22(38)25(6)15(4)24(5,36-23(31)40-25)17-9-16(7-8-18(17)27)35-21(37)19-10-33-20(11-32-19)39-12-26(28,29)30/h7-11,13-15H,12H2,1-6H3,(H2,31,36)(H,34,38)(H,35,37)/t14-,15?,24+,25+/m1/s1 |
| InChIKey | OFEPHFJMHMXHNZ-UXRPMCPHSA-N |
| XLogP | 4.64 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |