C22H22F4N6O4S — CID 118866337
(1S,5S,6S)-3-amino-5-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-N-methoxy-N,5-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide (PubChem CID 118866337) has the molecular formula C22H22F4N6O4S and a molecular weight of 542.52 g/mol. Its IUPAC name is (1S,5S,6S)-3-amino-5-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-N-methoxy-N,5-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide.
| Compound Name | (1S,5S,6S)-3-amino-5-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-N-methoxy-N,5-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 118866337 |
| Molecular Formula | C22H22F4N6O4S |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | (1S,5S,6S)-3-amino-5-[2-fluoro-5-[[5-(2,2,2-trifluoroethoxy)pyrazine-2-carbonyl]amino]phenyl]-N-methoxy-N,5-dimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
| SMILES | CON(C)C(=O)[C@]12C[C@H]1[C@@](C)(c1cc(NC(=O)c3cnc(OCC(F)(F)F)cn3)ccc1F)N=C(N)S2 |
| InChI | InChI=1S/C22H22F4N6O4S/c1-20(15-7-21(15,37-19(27)31-20)18(34)32(2)35-3)12-6-11(4-5-13(12)23)30-17(33)14-8-29-16(9-28-14)36-10-22(24,25)26/h4-6,8-9,15H,7,10H2,1-3H3,(H2,27,31)(H,30,33)/t15-,20+,21-/m0/s1 |
| InChIKey | HWECPTSOHDYWEG-RVHYNSKXSA-N |
| XLogP | 2.86 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|