C22H22F4N4O3S — CID 118866726
N-[3-[(1S,5R,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 118866726) has the molecular formula C22H22F4N4O3S and a molecular weight of 498.50 g/mol. Its IUPAC name is N-[3-[(1S,5R,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(1S,5R,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118866726 |
| Molecular Formula | C22H22F4N4O3S |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | N-[3-[(1S,5R,6S)-3-amino-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | COC[C@]12C[C@H]1[C@](C)(c1cc(NC(=O)c3ccc(OCC(F)(F)F)cn3)ccc1F)N=C(N)S2 |
| InChI | InChI=1S/C22H22F4N4O3S/c1-20(17-8-21(17,10-32-2)34-19(27)30-20)14-7-12(3-5-15(14)23)29-18(31)16-6-4-13(9-28-16)33-11-22(24,25)26/h3-7,9,17H,8,10-11H2,1-2H3,(H2,27,30)(H,29,31)/t17-,20-,21+/m0/s1 |
| InChIKey | UWFIGXANGVDXEC-DZFGPLHGSA-N |
| XLogP | 4.10 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |