C20H18F5N5O2S — CID 118866462
N-[3-[(1S,5R,6S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 118866462) has the molecular formula C20H18F5N5O2S and a molecular weight of 487.45 g/mol. Its IUPAC name is N-[3-[(1S,5R,6S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(1S,5R,6S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118866462 |
| Molecular Formula | C20H18F5N5O2S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-[3-[(1S,5R,6S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | C[C@@]1(c2cc(NC(=O)c3cnc(OCC(F)(F)F)cn3)ccc2F)N=C(N)S[C@@]2(CF)C[C@H]21 |
| InChI | InChI=1S/C20H18F5N5O2S/c1-18(14-5-19(14,8-21)33-17(26)30-18)11-4-10(2-3-12(11)22)29-16(31)13-6-28-15(7-27-13)32-9-20(23,24)25/h2-4,6-7,14H,5,8-9H2,1H3,(H2,26,30)(H,29,31)/t14-,18-,19+/m0/s1 |
| InChIKey | DNTWWRAWNMXRDW-ZOCIIQOWSA-N |
| XLogP | 3.81 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |