C25H28F4N6O3S — CID 126488625
N-[3-[(4S,5S,6S)-2-amino-4,5,6-trimethyl-6-(pyrrolidine-1-carbonyl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 126488625) has the molecular formula C25H28F4N6O3S and a molecular weight of 568.60 g/mol. Its IUPAC name is N-[3-[(4S,5S,6S)-2-amino-4,5,6-trimethyl-6-(pyrrolidine-1-carbonyl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,5S,6S)-2-amino-4,5,6-trimethyl-6-(pyrrolidine-1-carbonyl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126488625 |
| Molecular Formula | C25H28F4N6O3S |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | N-[3-[(4S,5S,6S)-2-amino-4,5,6-trimethyl-6-(pyrrolidine-1-carbonyl)-5H-1,3-thiazin-4-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | C[C@@H]1[C@@](C)(C(=O)N2CCCC2)SC(N)=N[C@]1(C)c1cc(NC(=O)c2cnc(OCC(F)(F)F)cn2)ccc1F |
| InChI | InChI=1S/C25H28F4N6O3S/c1-14-23(2,34-22(30)39-24(14,3)21(37)35-8-4-5-9-35)16-10-15(6-7-17(16)26)33-20(36)18-11-32-19(12-31-18)38-13-25(27,28)29/h6-7,10-12,14H,4-5,8-9,13H2,1-3H3,(H2,30,34)(H,33,36)/t14-,23-,24-/m0/s1 |
| InChIKey | MUVLFASUIMTWQW-VCYFOLNLSA-N |
| XLogP | 4.10 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |