C21H19F6N5O2S — CID 126488177
N-[5-[(1S,5S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-6-fluoro-3-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide (PubChem CID 126488177) has the molecular formula C21H19F6N5O2S and a molecular weight of 519.47 g/mol. Its IUPAC name is N-[5-[(1S,5S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-6-fluoro-3-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide.
| Compound Name | N-[5-[(1S,5S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-6-fluoro-3-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126488177 |
| Molecular Formula | C21H19F6N5O2S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-[5-[(1S,5S)-3-amino-1-(fluoromethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-6-fluoro-3-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
| SMILES | C[C@]1(c2cc(NC(=O)c3ccc(OCC(F)(F)C(F)F)cn3)cnc2F)N=C(N)S[C@@]2(CF)CC21 |
| InChI | InChI=1S/C21H19F6N5O2S/c1-19(14-5-20(14,8-22)35-18(28)32-19)12-4-10(6-30-15(12)23)31-16(33)13-3-2-11(7-29-13)34-9-21(26,27)17(24)25/h2-4,6-7,14,17H,5,8-9H2,1H3,(H2,28,32)(H,31,33)/t14?,19-,20-/m1/s1 |
| InChIKey | SRKSUJKSFAFNCL-LZVFCHHLSA-N |
| XLogP | 4.15 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|