C22H21F5N4O4 — CID 123170904
N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide (PubChem CID 123170904) has the molecular formula C22H21F5N4O4 and a molecular weight of 500.42 g/mol. Its IUPAC name is N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123170904 |
| Molecular Formula | C22H21F5N4O4 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[3-(2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
| SMILES | CC12COCC1(c1cc(NC(=O)c3ccc(OCC(F)(F)C(F)F)cn3)ccc1F)N=C(N)OC2 |
| InChI | InChI=1S/C22H21F5N4O4/c1-20-8-33-10-21(20,31-19(28)35-9-20)14-6-12(2-4-15(14)23)30-17(32)16-5-3-13(7-29-16)34-11-22(26,27)18(24)25/h2-7,18H,8-11H2,1H3,(H2,28,31)(H,30,32) |
| InChIKey | HSWWFZFZGSOIHT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|