C29H34F5N5O5S — CID 145257601
tert-butyl N-[(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-3-yl]carbamate (PubChem CID 145257601) has the molecular formula C29H34F5N5O5S and a molecular weight of 659.68 g/mol. Its IUPAC name is tert-butyl N-[(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-3-yl]carbamate |
|---|---|
| PubChem CID | 145257601 |
| Molecular Formula | C29H34F5N5O5S |
| Molecular Weight | 659.68 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | tert-butyl N-[(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@](C)(c2cc(NC(=O)c3ccc(OCC(F)(F)C(F)F)cn3)ccc2F)C2CCN=S2(=O)C1(C)C |
| InChI | InChI=1S/C29H34F5N5O5S/c1-26(2,3)44-25(41)38-24-27(4,5)45(42)21(11-12-36-45)28(6,39-24)18-13-16(7-9-19(18)30)37-22(40)20-10-8-17(14-35-20)43-15-29(33,34)23(31)32/h7-10,13-14,21,23H,11-12,15H2,1-6H3,(H,37,40)(H,38,39,41)/t21?,28-,45?/m1/s1 |
| InChIKey | ZLAXBYKPFJQBJL-VROOIJPSSA-N |
| XLogP | 5.92 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|