C24H27F5N6O3S — CID 121278428
N-[6-[(1S,6S,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide (PubChem CID 121278428) has the molecular formula C24H27F5N6O3S and a molecular weight of 574.58 g/mol. Its IUPAC name is N-[6-[(1S,6S,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide.
| Compound Name | N-[6-[(1S,6S,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 121278428 |
| Molecular Formula | C24H27F5N6O3S |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | N-[6-[(1S,6S,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2nc(NC(=O)c3ccc(OCC(F)(F)C(F)F)cn3)ccc2F)[C@@H]2CCCN=[S@]21=O |
| InChI | InChI=1S/C24H27F5N6O3S/c1-22(2)21(30)35-23(3,16-5-4-10-32-39(16,22)37)18-14(25)7-9-17(33-18)34-19(36)15-8-6-13(11-31-15)38-12-24(28,29)20(26)27/h6-9,11,16,20H,4-5,10,12H2,1-3H3,(H2,30,35)(H,33,34,36)/t16-,23-,39-/m0/s1 |
| InChIKey | GSQQJVQNFNXJFU-AZQMEYCESA-N |
| XLogP | 4.14 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|