C21H26F2N6O3S — CID 121267997
N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(fluoromethoxy)pyridine-2-carboxamide (PubChem CID 121267997) has the molecular formula C21H26F2N6O3S and a molecular weight of 480.54 g/mol. Its IUPAC name is N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(fluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(fluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 121267997 |
| Molecular Formula | C21H26F2N6O3S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(fluoromethoxy)pyridine-2-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2nc(NC(=O)c3ccc(OCF)cn3)ccc2F)[C@H]2CCNS21O |
| InChI | InChI=1S/C21H26F2N6O3S/c1-20(2)19(24)29-21(3,15-8-9-26-33(15,20)31)17-13(23)5-7-16(27-17)28-18(30)14-6-4-12(10-25-14)32-11-22/h4-7,10,15,26,31H,8-9,11H2,1-3H3,(H2,24,29)(H,27,28,30)/t15-,21+/m1/s1 |
| InChIKey | MLCVPZXZUNSOIP-VFNWGFHPSA-N |
| XLogP | 3.09 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |