C25H31F5N6O3S — CID 121268076
N-[6-[(7R,8R)-10-amino-1-hydroxy-8,11,11-trimethyl-1λ4-thia-2,9-diazabicyclo[5.4.0]undec-9-en-8-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide (PubChem CID 121268076) has the molecular formula C25H31F5N6O3S and a molecular weight of 590.62 g/mol. Its IUPAC name is N-[6-[(7R,8R)-10-amino-1-hydroxy-8,11,11-trimethyl-1λ4-thia-2,9-diazabicyclo[5.4.0]undec-9-en-8-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide.
| Compound Name | N-[6-[(7R,8R)-10-amino-1-hydroxy-8,11,11-trimethyl-1λ4-thia-2,9-diazabicyclo[5.4.0]undec-9-en-8-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 121268076 |
| Molecular Formula | C25H31F5N6O3S |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[6-[(7R,8R)-10-amino-1-hydroxy-8,11,11-trimethyl-1λ4-thia-2,9-diazabicyclo[5.4.0]undec-9-en-8-yl]-5-fluoro-2-pyridinyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2nc(NC(=O)c3ccc(OCC(F)(F)C(F)F)cn3)ccc2F)[C@H]2CCCCNS21O |
| InChI | InChI=1S/C25H31F5N6O3S/c1-23(2)22(31)36-24(3,17-6-4-5-11-33-40(17,23)38)19-15(26)8-10-18(34-19)35-20(37)16-9-7-14(12-32-16)39-13-25(29,30)21(27)28/h7-10,12,17,21,33,38H,4-6,11,13H2,1-3H3,(H2,31,36)(H,34,35,37)/t17-,24+/m1/s1 |
| InChIKey | INCOTBIUENFAOY-OSPHWJPCSA-N |
| XLogP | 4.85 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|