C22H26FN7O2S — CID 121268091
N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 121268091) has the molecular formula C22H26FN7O2S and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 121268091 |
| Molecular Formula | C22H26FN7O2S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cnc1C(=O)Nc1ccc(F)c([C@@]2(C)N=C(N)C(C)(C)S3(O)NCC[C@H]23)n1 |
| InChI | InChI=1S/C22H26FN7O2S/c1-12-9-13(10-24)11-26-17(12)19(31)29-16-6-5-14(23)18(28-16)22(4)15-7-8-27-33(15,32)21(2,3)20(25)30-22/h5-6,9,11,15,27,32H,7-8H2,1-4H3,(H2,25,30)(H,28,29,31)/t15-,22+/m1/s1 |
| InChIKey | YSQVZCNNGCXFOQ-QRQCRPRQSA-N |
| XLogP | 2.97 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |