C22H24ClFN6O2S — CID 126572943
N-[3-[(5R,6S)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide (PubChem CID 126572943) has the molecular formula C22H24ClFN6O2S and a molecular weight of 490.99 g/mol. Its IUPAC name is N-[3-[(5R,6S)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(5R,6S)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 126572943 |
| Molecular Formula | C22H24ClFN6O2S |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[3-[(5R,6S)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(NC(=O)c3ncc(C#N)cc3Cl)ccc2F)[C@@H]2CCNS21O |
| InChI | InChI=1S/C22H24ClFN6O2S/c1-21(2)20(26)30-22(3,17-6-7-28-33(17,21)32)14-9-13(4-5-16(14)24)29-19(31)18-15(23)8-12(10-25)11-27-18/h4-5,8-9,11,17,28,32H,6-7H2,1-3H3,(H2,26,30)(H,29,31)/t17-,22+/m0/s1 |
| InChIKey | NGYYPACQUKHUQV-HTAPYJJXSA-N |
| XLogP | 3.92 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |