C24H30FN5O4S — CID 126572923
[(5R,6S)-5-[5-[(3,5-dimethylpyridine-2-carbonyl)amino]-2-fluorophenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid (PubChem CID 126572923) has the molecular formula C24H30FN5O4S and a molecular weight of 503.60 g/mol. Its IUPAC name is [(5R,6S)-5-[5-[(3,5-dimethylpyridine-2-carbonyl)amino]-2-fluorophenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid.
| Compound Name | [(5R,6S)-5-[5-[(3,5-dimethylpyridine-2-carbonyl)amino]-2-fluorophenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid |
|---|---|
| PubChem CID | 126572923 |
| Molecular Formula | C24H30FN5O4S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | [(5R,6S)-5-[5-[(3,5-dimethylpyridine-2-carbonyl)amino]-2-fluorophenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid |
| SMILES | Cc1cnc(C(=O)Nc2ccc(F)c([C@@]3(C)N=C(NC(=O)O)C(C)(C)S4(O)NCC[C@@H]34)c2)c(C)c1 |
| InChI | InChI=1S/C24H30FN5O4S/c1-13-10-14(2)19(26-12-13)20(31)28-15-6-7-17(25)16(11-15)24(5)18-8-9-27-35(18,34)23(3,4)21(30-24)29-22(32)33/h6-7,10-12,18,27,34H,8-9H2,1-5H3,(H,28,31)(H,29,30)(H,32,33)/t18-,24+/m0/s1 |
| InChIKey | GUKKIUBJYOWCIX-MHECFPHRSA-N |
| XLogP | 4.32 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |