C25H28F5N5O5S — CID 126572917
[(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid (PubChem CID 126572917) has the molecular formula C25H28F5N5O5S and a molecular weight of 605.59 g/mol. Its IUPAC name is [(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid.
| Compound Name | [(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid |
|---|---|
| PubChem CID | 126572917 |
| Molecular Formula | C25H28F5N5O5S |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | [(5R,6S)-5-[2-fluoro-5-[[5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonyl]amino]phenyl]-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-3-yl]carbamic acid |
| SMILES | CC1(C)C(NC(=O)O)=N[C@](C)(c2cc(NC(=O)c3ccc(OCC(F)(F)C(F)F)cn3)ccc2F)[C@@H]2CCNS21O |
| InChI | InChI=1S/C25H28F5N5O5S/c1-23(2)21(34-22(37)38)35-24(3,18-8-9-32-41(18,23)39)15-10-13(4-6-16(15)26)33-19(36)17-7-5-14(11-31-17)40-12-25(29,30)20(27)28/h4-7,10-11,18,20,32,39H,8-9,12H2,1-3H3,(H,33,36)(H,34,35)(H,37,38)/t18-,24+/m0/s1 |
| InChIKey | QHZKEBDDCBEPKB-MHECFPHRSA-N |
| XLogP | 4.98 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|