C21H25F3N6O3S — CID 121268026
N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 121268026) has the molecular formula C21H25F3N6O3S and a molecular weight of 498.53 g/mol. Its IUPAC name is N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 121268026 |
| Molecular Formula | C21H25F3N6O3S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[6-[(5R,6R)-3-amino-1-hydroxy-2,2,5-trimethyl-1λ4-thia-4,9-diazabicyclo[4.3.0]non-3-en-5-yl]-5-fluoro-2-pyridinyl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | CC1(C)C(N)=N[C@](C)(c2nc(NC(=O)c3ccc(OC(F)F)cn3)ccc2F)[C@H]2CCNS21O |
| InChI | InChI=1S/C21H25F3N6O3S/c1-20(2)18(25)30-21(3,14-8-9-27-34(14,20)32)16-12(22)5-7-15(28-16)29-17(31)13-6-4-11(10-26-13)33-19(23)24/h4-7,10,14,19,27,32H,8-9H2,1-3H3,(H2,25,30)(H,28,29,31)/t14-,21+/m1/s1 |
| InChIKey | XKDSVUWVRRKYGP-SZNDQCEHSA-N |
| XLogP | 3.39 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |