C21H25FN6O2S — CID 163985065
N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-2-methylpyrimidine-5-carboxamide (PubChem CID 163985065) has the molecular formula C21H25FN6O2S and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-2-methylpyrimidine-5-carboxamide.
| Compound Name | N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-2-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 163985065 |
| Molecular Formula | C21H25FN6O2S |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[3-[(1R,5R)-3-amino-2,2,5-trimethyl-1-oxo-1λ6-thia-4,9-diazabicyclo[4.3.0]nona-1(9),3-dien-5-yl]-4-fluorophenyl]-2-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)Nc2ccc(F)c([C@@]3(C)N=C(N)C(C)(C)[S@@]4(=O)=NCCC34)c2)cn1 |
| InChI | InChI=1S/C21H25FN6O2S/c1-12-24-10-13(11-25-12)18(29)27-14-5-6-16(22)15(9-14)21(4)17-7-8-26-31(17,30)20(2,3)19(23)28-21/h5-6,9-11,17H,7-8H2,1-4H3,(H2,23,28)(H,27,29)/t17?,21-,31-/m1/s1 |
| InChIKey | TVORWXLXWSTRPQ-KSLFGHPJSA-N |
| XLogP | 2.78 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |