C20H19F2N5OS — CID 118440913
N-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 118440913) has the molecular formula C20H19F2N5OS and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 118440913 |
| Molecular Formula | C20H19F2N5OS |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cnc1C(=O)Nc1ccc(F)c([C@@]2(C)N=C(N)S[C@H](C)[C@@H]2F)c1 |
| InChI | InChI=1S/C20H19F2N5OS/c1-10-6-12(8-23)9-25-16(10)18(28)26-13-4-5-15(21)14(7-13)20(3)17(22)11(2)29-19(24)27-20/h4-7,9,11,17H,1-3H3,(H2,24,27)(H,26,28)/t11-,17+,20-/m1/s1 |
| InChIKey | NZUDMAQASZUZKF-CGQHOMIXSA-N |
| XLogP | 3.66 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |