C21H20F3N5O2 — CID 118242049
N-[3-[(4R,5S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 118242049) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is N-[3-[(4R,5S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[3-[(4R,5S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 118242049 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[3-[(4R,5S)-2-amino-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cnc1C(=O)Nc1cc(F)c(F)c([C@]2(CF)N=C(N)OC(C)[C@H]2C)c1 |
| InChI | InChI=1S/C21H20F3N5O2/c1-10-4-13(7-25)8-27-18(10)19(30)28-14-5-15(17(24)16(23)6-14)21(9-22)11(2)12(3)31-20(26)29-21/h4-6,8,11-12H,9H2,1-3H3,(H2,26,29)(H,28,30)/t11-,12?,21-/m1/s1 |
| InChIKey | LXLYRKCTJFGVEW-BDOSFLELSA-N |
| XLogP | 3.33 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |