C22H22F3N5O2S — CID 126488172
N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-6-(hydroxymethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 126488172) has the molecular formula C22H22F3N5O2S and a molecular weight of 477.51 g/mol. Its IUPAC name is N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-6-(hydroxymethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-6-(hydroxymethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 126488172 |
| Molecular Formula | C22H22F3N5O2S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[3-[(4S,5S,6S)-2-amino-4-(fluoromethyl)-6-(hydroxymethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cnc1C(=O)Nc1cc(F)c(F)c([C@@]2(CF)N=C(N)S[C@](C)(CO)[C@H]2C)c1 |
| InChI | InChI=1S/C22H22F3N5O2S/c1-11-4-13(7-26)8-28-18(11)19(32)29-14-5-15(17(25)16(24)6-14)22(9-23)12(2)21(3,10-31)33-20(27)30-22/h4-6,8,12,31H,9-10H2,1-3H3,(H2,27,30)(H,29,32)/t12-,21-,22+/m1/s1 |
| InChIKey | PSFSGUILUKTSQU-WLERDACDSA-N |
| XLogP | 3.41 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |