C20H19ClF4N4OS — CID 126488369
N-[3-[(4S,5S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 126488369) has the molecular formula C20H19ClF4N4OS and a molecular weight of 474.91 g/mol. Its IUPAC name is N-[3-[(4S,5S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(4S,5S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 126488369 |
| Molecular Formula | C20H19ClF4N4OS |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-[3-[(4S,5S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@@](C)(CF)SC(N)=N[C@]1(CF)c1cc(NC(=O)c2ccc(Cl)cn2)cc(F)c1F |
| InChI | InChI=1S/C20H19ClF4N4OS/c1-10-19(2,8-22)31-18(26)29-20(10,9-23)13-5-12(6-14(24)16(13)25)28-17(30)15-4-3-11(21)7-27-15/h3-7,10H,8-9H2,1-2H3,(H2,26,29)(H,28,30)/t10-,19-,20+/m1/s1 |
| InChIKey | BVMNSJPIAZIQCN-NIXNKXAPSA-N |
| XLogP | 4.86 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |