C20H17ClFN5O3 — CID 89451719
N-[3-[(4R,4aS,7aS)-2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide (PubChem CID 89451719) has the molecular formula C20H17ClFN5O3 and a molecular weight of 429.84 g/mol. Its IUPAC name is N-[3-[(4R,4aS,7aS)-2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(4R,4aS,7aS)-2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 89451719 |
| Molecular Formula | C20H17ClFN5O3 |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-[3-[(4R,4aS,7aS)-2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]-4-fluorophenyl]-3-chloro-5-cyanopyridine-2-carboxamide |
| SMILES | C[C@@]1(c2cc(NC(=O)c3ncc(C#N)cc3Cl)ccc2F)N=C(N)O[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C20H17ClFN5O3/c1-20(13-8-29-9-16(13)30-19(24)27-20)12-5-11(2-3-15(12)22)26-18(28)17-14(21)4-10(6-23)7-25-17/h2-5,7,13,16H,8-9H2,1H3,(H2,24,27)(H,26,28)/t13-,16+,20-/m0/s1 |
| InChIKey | KJTAVTFFVFUWGB-OWZDWXTDSA-N |
| XLogP | 2.57 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |