C23H25FN4O4 — CID 72663611
N-[3-(2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl)-4-fluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide (PubChem CID 72663611) has the molecular formula C23H25FN4O4 and a molecular weight of 440.48 g/mol. Its IUPAC name is N-[3-(2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl)-4-fluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-(2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl)-4-fluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 72663611 |
| Molecular Formula | C23H25FN4O4 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[3-(2-amino-4-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl)-4-fluorophenyl]-5-(cyclopropylmethoxy)pyridine-2-carboxamide |
| SMILES | CC1(c2cc(NC(=O)c3ccc(OCC4CC4)cn3)ccc2F)N=C(N)OC2COCC21 |
| InChI | InChI=1S/C23H25FN4O4/c1-23(17-11-30-12-20(17)32-22(25)28-23)16-8-14(4-6-18(16)24)27-21(29)19-7-5-15(9-26-19)31-10-13-2-3-13/h4-9,13,17,20H,2-3,10-12H2,1H3,(H2,25,28)(H,27,29) |
| InChIKey | DVLUMBHNMKHCHV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |