C21H23FN8O2S — CID 140884416
N-[6-[(7S,9R)-11-amino-9-methyl-7-oxo-7λ6-thia-1,3,10-triazabicyclo[5.4.0]undeca-6,10-dien-9-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 140884416) has the molecular formula C21H23FN8O2S and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[6-[(7S,9R)-11-amino-9-methyl-7-oxo-7λ6-thia-1,3,10-triazabicyclo[5.4.0]undeca-6,10-dien-9-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[6-[(7S,9R)-11-amino-9-methyl-7-oxo-7λ6-thia-1,3,10-triazabicyclo[5.4.0]undeca-6,10-dien-9-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 140884416 |
| Molecular Formula | C21H23FN8O2S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[6-[(7S,9R)-11-amino-9-methyl-7-oxo-7λ6-thia-1,3,10-triazabicyclo[5.4.0]undeca-6,10-dien-9-yl]-5-fluoro-2-pyridinyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cnc1C(=O)Nc1ccc(F)c([C@]2(C)C[S@@]3(=O)=CCCNCN3C(N)=N2)n1 |
| InChI | InChI=1S/C21H23FN8O2S/c1-13-8-14(9-23)10-26-17(13)19(31)28-16-5-4-15(22)18(27-16)21(2)11-33(32)7-3-6-25-12-30(33)20(24)29-21/h4-5,7-8,10,25H,3,6,11-12H2,1-2H3,(H2,24,29)(H,27,28,31)/t21-,33-/m0/s1 |
| InChIKey | HYZDCTGPVDKTEN-VTLMBFNKSA-N |
| XLogP | 0.85 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|