C22H27FN6O3S — CID 157213285
2-[6-[(1S,6R,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-1-(5-methoxypyrazin-2-yl)ethanone (PubChem CID 157213285) has the molecular formula C22H27FN6O3S and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[6-[(1S,6R,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-1-(5-methoxypyrazin-2-yl)ethanone.
| Compound Name | 2-[6-[(1S,6R,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-1-(5-methoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 157213285 |
| Molecular Formula | C22H27FN6O3S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[6-[(1S,6R,7R)-9-amino-7,10,10-trimethyl-1-oxo-1λ6-thia-2,8-diazabicyclo[4.4.0]deca-1,8-dien-7-yl]-5-fluoro-2-pyridinyl]-1-(5-methoxypyrazin-2-yl)ethanone |
| SMILES | COc1cnc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)C(C)(C)[S@]4(=O)=NCCC[C@H]34)n2)cn1 |
| InChI | InChI=1S/C22H27FN6O3S/c1-21(2)20(24)29-22(3,17-6-5-9-27-33(17,21)31)19-14(23)8-7-13(28-19)10-16(30)15-11-26-18(32-4)12-25-15/h7-8,11-12,17H,5-6,9-10H2,1-4H3,(H2,24,29)/t17-,22+,33+/m1/s1 |
| InChIKey | ASDBPBASRGXJJY-UFNPPLJESA-N |
| XLogP | 2.44 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |