C20H21F3N4O2 — CID 157322608
2-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone (PubChem CID 157322608) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is 2-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone.
| Compound Name | 2-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 157322608 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone |
| SMILES | COc1cnc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)[C@](C)(F)C[C@@H]3F)c2)cn1 |
| InChI | InChI=1S/C20H21F3N4O2/c1-19(23)8-16(22)20(2,27-18(19)24)12-6-11(4-5-13(12)21)7-15(28)14-9-26-17(29-3)10-25-14/h4-6,9-10,16H,7-8H2,1-3H3,(H2,24,27)/t16-,19+,20+/m0/s1 |
| InChIKey | BEIQJXNPPPHIKQ-PWIZWCRZSA-N |
| XLogP | 3.09 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |