C19H20F2N4O2S — CID 153029357
2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone (PubChem CID 153029357) has the molecular formula C19H20F2N4O2S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone.
| Compound Name | 2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 153029357 |
| Molecular Formula | C19H20F2N4O2S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluorophenyl]-1-(5-methoxypyrazin-2-yl)ethanone |
| SMILES | COc1cnc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)S[C@H](C)[C@@H]3F)c2)cn1 |
| InChI | InChI=1S/C19H20F2N4O2S/c1-10-17(21)19(2,25-18(22)28-10)12-6-11(4-5-13(12)20)7-15(26)14-8-24-16(27-3)9-23-14/h4-6,8-10,17H,7H2,1-3H3,(H2,22,25)/t10-,17+,19-/m1/s1 |
| InChIKey | VDMVFTVPHKENEX-XVWMFJGMSA-N |
| XLogP | 3.05 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |