C18H18F3N5O2S — CID 158895356
2-[6-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-5-fluoro-2-pyridinyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone (PubChem CID 158895356) has the molecular formula C18H18F3N5O2S and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[6-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-5-fluoro-2-pyridinyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone.
| Compound Name | 2-[6-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-5-fluoro-2-pyridinyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 158895356 |
| Molecular Formula | C18H18F3N5O2S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[6-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]-5-fluoro-2-pyridinyl]-1-[5-(fluoromethoxy)pyrazin-2-yl]ethanone |
| SMILES | C[C@H]1SC(N)=N[C@](C)(c2nc(CC(=O)c3cnc(OCF)cn3)ccc2F)[C@H]1F |
| InChI | InChI=1S/C18H18F3N5O2S/c1-9-15(21)18(2,26-17(22)29-9)16-11(20)4-3-10(25-16)5-13(27)12-6-24-14(7-23-12)28-8-19/h3-4,6-7,9,15H,5,8H2,1-2H3,(H2,22,26)/t9-,15+,18+/m1/s1 |
| InChIKey | JETMRIVBMCRBJD-OETHJERPSA-N |
| XLogP | 2.75 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |