C20H19FN4OS — CID 161183524
2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-(5-isocyano-2-pyridinyl)ethanone (PubChem CID 161183524) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-(5-isocyano-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-(5-isocyano-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 161183524 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[3-[(4R,5R,6R)-2-amino-5-fluoro-4,6-dimethyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-(5-isocyano-2-pyridinyl)ethanone |
| SMILES | [C-]#[N+]c1ccc(C(=O)Cc2cccc([C@@]3(C)N=C(N)S[C@H](C)[C@@H]3F)c2)nc1 |
| InChI | InChI=1S/C20H19FN4OS/c1-12-18(21)20(2,25-19(22)27-12)14-6-4-5-13(9-14)10-17(26)16-8-7-15(23-3)11-24-16/h4-9,11-12,18H,10H2,1-2H3,(H2,22,25)/t12-,18+,20-/m1/s1 |
| InChIKey | USUCFTLYUOOTSG-CCMJGWDWSA-N |
| XLogP | 4.06 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|