C22H25N3O2S — CID 160511848
2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-[5-[(E)-but-2-enoxy]-2-pyridinyl]ethanone (PubChem CID 160511848) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-[5-[(E)-but-2-enoxy]-2-pyridinyl]ethanone.
| Compound Name | 2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-[5-[(E)-but-2-enoxy]-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 160511848 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]-1-[5-[(E)-but-2-enoxy]-2-pyridinyl]ethanone |
| SMILES | C/C=C/COc1ccc(C(=O)Cc2cccc([C@]3(C)CCSC(N)=N3)c2)nc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-3-4-11-27-18-8-9-19(24-15-18)20(26)14-16-6-5-7-17(13-16)22(2)10-12-28-21(23)25-22/h3-9,13,15H,10-12,14H2,1-2H3,(H2,23,25)/b4-3+/t22-/m0/s1 |
| InChIKey | VMQOQMHMMJYGOO-SIAOZKNOSA-N |
| XLogP | 4.13 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|