C21H22F4N4O3 — CID 50992404
N-[3-[(5R)-3-amino-5,6,6-trimethyl-2H-1,4-oxazin-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 50992404) has the molecular formula C21H22F4N4O3 and a molecular weight of 454.42 g/mol. Its IUPAC name is N-[3-[(5R)-3-amino-5,6,6-trimethyl-2H-1,4-oxazin-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(5R)-3-amino-5,6,6-trimethyl-2H-1,4-oxazin-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 50992404 |
| Molecular Formula | C21H22F4N4O3 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-[3-[(5R)-3-amino-5,6,6-trimethyl-2H-1,4-oxazin-5-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | CC1(C)OCC(N)=N[C@]1(C)c1cc(NC(=O)c2ccc(OCC(F)(F)F)cn2)ccc1F |
| InChI | InChI=1S/C21H22F4N4O3/c1-19(2)20(3,29-17(26)10-32-19)14-8-12(4-6-15(14)22)28-18(30)16-7-5-13(9-27-16)31-11-21(23,24)25/h4-9H,10-11H2,1-3H3,(H2,26,29)(H,28,30)/t20-/m1/s1 |
| InChIKey | HBFFFCOUQILMKC-HXUWFJFHSA-N |
| XLogP | 3.80 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |