C23H23F3N6O3S — CID 126488412
N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide (PubChem CID 126488412) has the molecular formula C23H23F3N6O3S and a molecular weight of 520.54 g/mol. Its IUPAC name is N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126488412 |
| Molecular Formula | C23H23F3N6O3S |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N-[3-[(4S,6R)-2-amino-6-(fluoromethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-3-methyl-5-(1,3-oxazol-2-ylmethoxy)pyrazine-2-carboxamide |
| SMILES | Cc1nc(OCc2ncco2)cnc1C(=O)Nc1cc(F)c(F)c([C@]2(C)C[C@](C)(CF)SC(N)=N2)c1 |
| InChI | InChI=1S/C23H23F3N6O3S/c1-12-19(29-8-16(30-12)35-9-17-28-4-5-34-17)20(33)31-13-6-14(18(26)15(25)7-13)23(3)10-22(2,11-24)36-21(27)32-23/h4-8H,9-11H2,1-3H3,(H2,27,32)(H,31,33)/t22-,23+/m1/s1 |
| InChIKey | YTDRJXMHWZDEGS-PKTZIBPZSA-N |
| XLogP | 4.28 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |