C24H27F2N5O3S — CID 126488665
N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-pent-3-ynoxypyrazine-2-carboxamide (PubChem CID 126488665) has the molecular formula C24H27F2N5O3S and a molecular weight of 503.58 g/mol. Its IUPAC name is N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-pent-3-ynoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-pent-3-ynoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126488665 |
| Molecular Formula | C24H27F2N5O3S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N-[3-[(4S,6R)-2-amino-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluorophenyl]-5-pent-3-ynoxypyrazine-2-carboxamide |
| SMILES | CC#CCCOc1cnc(C(=O)Nc2cc(F)c(F)c([C@]3(C)C[C@](C)(COC)SC(N)=N3)c2)cn1 |
| InChI | InChI=1S/C24H27F2N5O3S/c1-5-6-7-8-34-19-12-28-18(11-29-19)21(32)30-15-9-16(20(26)17(25)10-15)24(3)13-23(2,14-33-4)35-22(27)31-24/h9-12H,7-8,13-14H2,1-4H3,(H2,27,31)(H,30,32)/t23-,24+/m1/s1 |
| InChIKey | LSRBNBJUCBQCJS-RPWUZVMVSA-N |
| XLogP | 3.87 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|